Source code for alf.environments.suite_carla

# Copyright (c) 2020 Horizon Robotics and ALF Contributors. All Rights Reserved.
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
#      http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
"""CarlaEnvironment suite.

To use this, there are two ways:

1. Run the code within docker image horizonrobotics/alf:0.0.3-carla
   Both `Docker <https://docs.docker.com/engine/install/ubuntu/>`_ and
   `Nvidia-Docker2 <https://github.com/NVIDIA/nvidia-docker>`_ need to be installed.

2. Install carla:

.. code-block:: bash

    wget https://carla-releases.s3.eu-west-3.amazonaws.com/Linux/CARLA_0.9.9.tar.gz
    mkdir carla
    tar zxf CARLA_0.9.9.tar.gz -C carla
    cd carla/Import
    wget https://carla-releases.s3.eu-west-3.amazonaws.com/Linux/AdditionalMaps_0.9.9.tar.gz
    cd ..
    ./ImportAssert.sh
    easy_install PythonAPI/carla/dist/carla-0.9.9-py3.7-linux-x86_64.egg
    pip install networkx==2.2

Make sure you are using python3.7

"""

from collections import OrderedDict
from absl import logging
import math
import numpy as np
import os
import random
import scipy.interpolate
import subprocess
import sys
import time
import torch
from unittest.mock import Mock
import weakref

try:
    import carla
except ImportError:
    # create 'carla' as a mock to not break python argument type hints
    carla = Mock()

import alf
import alf.data_structures as ds
from alf.utils import common
from .alf_environment import AlfEnvironment
from .carla_sensors import (
    BEVSensor, CameraSensor, CollisionSensor, GnssSensor, IMUSensor,
    LaneInvasionSensor, NavigationSensor, RadarSensor, RedlightSensor,
    DynamicObjectSensor, ObstacleDetectionSensor, World, get_scaled_image_size,
    MINIMUM_RENDER_WIDTH, MINIMUM_RENDER_HEIGHT)

from alf.environments.carla_env.carla_utils import (
    _calculate_relative_position, _calculate_relative_velocity, _get_self_pose,
    geo_distance, _to_numpy_loc)


[docs]def is_available(): return not isinstance(carla, Mock)
[docs]class WeatherParameters(object): """A class for a set of weather related parameters. Currently it contains all the weather fields from ``carla.WeatherParameters`` except for ``sun_azimuth_angle`` and ``sun_altitude_angle``, which are controlled separately by ``day_length`` in a more realistic way. """ def __init__(self, cloudiness=0, precipitation=0, precipitation_deposits=0, wind_intensity=0, fog_density=0, fog_distance=0): self.cloudiness = cloudiness # [0, 100] self.precipitation = precipitation # [0, 100] self.precipitation_deposits = precipitation_deposits # [0, 100] self.wind_intensity = wind_intensity # [0, 100] self.fog_density = fog_density # [0, 100] self.fog_distance = fog_distance # [0, 100] self._fields = [ m for m in self.__dict__.keys() if not m.startswith('_') ]
[docs] def get_weather_fields(self): """ Get the list of configurable weather fields Returns: A list of strings, each as the name of a configurable field """ return self._fields
def __add__(self, other): """ Add other to current parameters and return a new instance. Args: other (WeatherParameters) """ new_param = type(self)() for m in self.get_weather_fields(): setattr(new_param, m, getattr(self, m) + getattr(other, m)) return new_param def __sub__(self, other): """ Subtract other from current parameters and return a new instance. Args: other (WeatherParameters) """ new_param = type(self)() for m in self.get_weather_fields(): setattr(new_param, m, getattr(self, m) - getattr(other, m)) return new_param def __truediv__(self, value): """ Divide the current parameters by value and return a new instance. Args: value(float|int): a number to divide the parameters by """ assert type(value) == int or type(value) == float value = float(value) new_param = type(self)() for m in self.get_weather_fields(): setattr(new_param, m, getattr(self, m) / value) return new_param def __len__(self): """ Get the number of configurable weather fields """ return len(self.get_weather_fields()) def __str__(self): return ''.join([ '{a}: {b} '.format(a=m, b=getattr(self, m)) for m in self.get_weather_fields() ])
[docs]def extract_weather_parameters(weather_param: carla.WeatherParameters): """Extract the parameters according to the fields in ``WeatherParameters`` and use them to construct an instance of ``WeatherParameters``. """ wp = WeatherParameters() for m in wp.get_weather_fields(): setattr(wp, m, getattr(weather_param, m)) return wp
[docs]def adjust_weather_parameters(weather_param: carla.WeatherParameters, delta: WeatherParameters): """Adjust the parameters of ``weather_param`` according to the fields in ``WeatherParameters``. The value is adjusted by adding the field value of ``delta`` to ``weather_param``. Args: weather_param (carla.WeatherParameters): a ``carla.WeatherParameters`` instance containing the parameters to be adjusted delta (WeatherParameters): an instance of ``WeatherParameters`` with the value of each field representing the amount to be adjusted Returns: The input weather_param instance with adjusted field values. """ for m in delta.get_weather_fields(): setattr(weather_param, m, getattr(weather_param, m) + getattr(delta, m)) return weather_param
[docs]@alf.configurable(blacklist=['actor', 'alf_world']) class Player(object): """Player is a vehicle with some sensors. An episode terminates if it reaches one of the following situations: 1. the vehicle arrives at the goal. 2. the time exceeds ``route_length / min_speed + additional_time``. 3. it get stuck because of a collision. At each step, the reward is given based on the following components: 1. Arriving goal: ``success_reward`` 2. Moving in the navigation direction: the number of meters moved This moving reward can be either dense of sparse depending on the argument ``sparse_reward``. 3. Negative reward caused by collision: ``-min(max_collision_reward, max(epside_reward, 0))`` Currently, the player has these sensors: ``CollisionSensor``, ``GnssSensor``, ``IMUSensor``, ``CameraSensor``, ``BEV_sensor``, ``LaneInvasionSensor``, ``RadarSensor``, ``NavigationSensor``. See the documentation for these class for the definition the data generated by these sensors. """ # over all reward REWARD_OVERALL = 0 # distance in meter for moving along route # If using sparse reward (`sparse_reward` is True), this reward is only given # about every `sparse_reward_interval` meters # If not using sparse reward, this reward is given every steps. REWARD_DISTANCE = 1 # 0/1 valued indicating whether there is collision REWARD_COLLISION = 2 # 0/1 valued indicating reaching goal REWARD_SUCCESS = 3 # 0/1 valued indicating red light violation REWARD_RED_LIGHT = 4 # 0/1 valued indicating overspeed REWARD_OVERSPEED = 5 # dimension of the reward vector REWARD_DIMENSION = 6 # See https://leaderboard.carla.org/#driving-score for reference PENALTY_RATE_COLLISION = 0.50 PENALTY_RATE_RED_LIGHT = 0.30 def __init__(self, actor, alf_world, controller_ctor=None, success_reward=100., success_distance_thresh=5.0, max_collision_penalty=20., max_stuck_at_collision_seconds=5.0, stuck_at_collision_distance=1.0, max_red_light_penalty=10., overspeed_penalty_weight=0., sparse_reward=False, sparse_reward_interval=10., allow_negative_distance_reward=True, min_speed=5., additional_time=0., with_gnss_sensor=True, with_imu_sensor=True, with_camera_sensor=True, with_radar_sensor=True, with_bev_sensor=False, with_dynamic_object_sensor=False, data_collection_mode=False, with_red_light_sensor=False, with_obstacle_sensor=False, terminate_upon_infraction="", render_waypoints=True): """ Args: actor (carla.Actor): the carla actor object alf_world (Wolrd): the world containing the player controller_ctor (Callable|None): if provided, will be as ``controller_ctor(vehicle, step_time)`` to create a vehicle controller. It will be used to process the action and generate the control. success_reward (float): the reward for arriving the goal location. success_distance_thresh (float): success is achieved if the current location is with such distance of the goal max_collision_penalty (float): the maximum penalty (i.e. negative reward) for collision. We don't want the collision penalty to be too large if the player cannot even get enough positive moving reward. So the penalty is capped at ``Player.PENALTY_RATE_COLLISION * max(0., episode_reward))``. Note that this reward is only given once at the first step of contiguous collisions. max_stuck_at_collision_seconds (float): the episode will end and is considerred as failure if the car is stuck at the collision for so many seconds, stuck_at_collision_distance (float): the car is considerred as being stuck at the collision if it is within such distance of the first collision location. max_red_light_penalty (float): the maximum penalty (i.e. negative reward) for red light violation. We don't want the red light penalty to be too large if the player cannot even get enough positive moving reward. So the penalty is capped at ``Player.PENALTY_RATE_RED_LIGHT * max(0., episode_reward))``. Note that this reward is only given once at the first step of contiguous red light violation. overspeed_penalty_weight (float): if > 0, a penalty proportional to the overspeed magnitude will be applied, multiplied by the step time (seconds each step of simulation represents) to make the penalty invariant to it, and then multiplied by the weight of ``overspeed_penalty_weight``. A negative value is the same as 0. sparse_reward (bool): If False, the distance reward is given at every step based on how much it moves along the navigation route. If True, the distance reward is only given after moving ``sparse_reward_distance``. sparse_reward_interval (float): the sparse reward is given after approximately every such distance along the route has been driven. allow_negative_distance_reward (True): whether to allow negative distance reward. If True, the agent will receive positive reward for moving ahead along the route, and negative reward for moving back along the route. If False, the agent still receives positive reward for moving ahead along the route, but will not receive negative reward for moving back along the route. Instead, the negative distance will be accumulated to the future distance reward. This may ease the learning if the right behavior is to temporarily go back along the route in order, for examle, to avoid obstacle. min_speed (float): unit is m/s. Failure if route_length / min_speed + additional_time seconds passed additional_time (float): additional time (unit is second) provided to the agent in each episode. This is useful especially for the episodes with short route_lengths (e.g. < 50m), as it takes some time for the car to be able to move (because of initial spawning phase with z > 0 and acceleration phase). with_gnss_sensor (bool): whether to use ``GnssSensor``. with_imu_sensor (bool): whether to use ``IMUSensor``. with_camera_sensor (bool): whether to use ``CameraSensor``. with_radar_sensor (bool): whether to use ``RadarSensor``. with_bev_sensor (bool): whether to use ``BEVSensor``. data_collection_mode (bool): if True, will use Rule-based agents to control the Players. This can be used for purposes such as collecting data. with_red_light_sensor (bool): whether to use ``RedlightSensor``. with_obstacle_sensor (bool): whether to use ``ObstacleDetectionSensor``. terminate_upon_infraction (str): whether to terminate the episode based on the specified mode ("collision", "redlight", "all", ""), when the agent has the corresponding infractions. If "", no infraction-based termination is activated. render_waypoints (bool): whether to render (interpolated) waypoints in the generated video during rendering. Note that it is only used for visualization and has no impacts on the perception data. """ self._actor = actor self._alf_world = alf_world self._observation_sensors = {} self._render_waypoints = render_waypoints assert terminate_upon_infraction in ('collision', 'redlight', 'all', '') self._terminate_upon_infraction = terminate_upon_infraction self._collision_sensor = CollisionSensor(actor) self._observation_sensors['collision'] = self._collision_sensor if with_gnss_sensor: self._gnss_sensor = GnssSensor(actor) self._observation_sensors['gnss'] = self._gnss_sensor else: self._gnss_sensor = None if with_imu_sensor: self._imu_sensor = IMUSensor(actor) self._observation_sensors['imu'] = self._imu_sensor else: self._imu_sensor = None if with_camera_sensor: self._camera_sensor = CameraSensor(actor) self._observation_sensors['camera'] = self._camera_sensor else: self._camera_sensor = None self._lane_invasion_sensor = LaneInvasionSensor(actor) if with_radar_sensor: self._radar_sensor = RadarSensor(actor) self._observation_sensors['radar'] = self._radar_sensor else: self._radar_sensor = None self._navigation = NavigationSensor(actor, alf_world) self._observation_sensors['navigation'] = self._navigation if with_bev_sensor: self._bev_sensor = BEVSensor(actor, self._alf_world, self._navigation) self._observation_sensors['bev'] = self._bev_sensor else: self._bev_sensor = None if with_dynamic_object_sensor: self._dynamic_object_sensor = DynamicObjectSensor( actor, self._alf_world) self._observation_sensors[ 'dynamic_object'] = self._dynamic_object_sensor else: self._dynamic_object_sensor = None self._data_collection_mode = data_collection_mode if self._data_collection_mode: from .carla_env.carla_agents import SimpleNavigationAgent self._data_agent = SimpleNavigationAgent(actor, self._navigation, alf_world) if with_red_light_sensor: self._red_light_sensor = RedlightSensor(actor, weakref.ref(self)) self._observation_sensors['redlight'] = self._red_light_sensor self._with_obstacle_sensor = with_obstacle_sensor if with_obstacle_sensor: self._obstacle_sensor = ObstacleDetectionSensor(actor) self._observation_sensors['obstacle'] = self._obstacle_sensor self._success_reward = success_reward self._success_distance_thresh = success_distance_thresh self._min_speed = min_speed self._additional_time = additional_time self._delta_seconds = actor.get_world().get_settings( ).fixed_delta_seconds self._max_collision_penalty = max_collision_penalty self._max_stuck_at_collision_frames = max_stuck_at_collision_seconds / self._delta_seconds self._stuck_at_collision_distance = stuck_at_collision_distance self._max_red_light_penalty = max_red_light_penalty self._overspeed_penalty_weight = max(overspeed_penalty_weight, 0) self._sparse_reward = sparse_reward self._sparse_reward_index_interval = int( max(1, sparse_reward_interval // self._alf_world.route_resolution)) self._allow_negative_distance_reward = allow_negative_distance_reward self._observation_spec = dict() self._observation_desc = dict() for sensor_name, sensor in self._observation_sensors.items(): self._observation_spec[sensor_name] = sensor.observation_spec() self._observation_desc[sensor_name] = sensor.observation_desc() self._observation_spec['goal'] = alf.TensorSpec([3]) self._observation_spec['velocity'] = alf.TensorSpec([3]) # UE4 coordinate system is left handed: # https://forums.unrealengine.com/development-discussion/c-gameplay-programming/103787-ue4-coordinate-system-not-right-handed self._observation_desc['goal'] = ( "Target location relative to the vehicle coordinate system in " "meters. X axis: front, Y axis: right, Z axis: up. Only the " "rotation around Z axis is taken into account when calculating the " "vehicle's coordinate system.") self._observation_desc['navigation'] = ( 'Relative positions of the future waypoints in the route') self._observation_desc[ 'velocity'] = "3D Velocity relative to self coordinate in m/s" self._info_spec = OrderedDict( success=alf.TensorSpec(()), collision=alf.TensorSpec(()), collision_front=alf.TensorSpec(()), red_light_violated=alf.TensorSpec(()), red_light_encountered=alf.TensorSpec(()), overspeed=alf.TensorSpec(())) self._control = carla.VehicleControl() self._controller = None if controller_ctor is not None: self._controller = controller_ctor(actor, self._delta_seconds) self.reset() # for rendering self._surface = None self._font = None self._clock = None
[docs] def reset(self): """Reset the player location and goal. Use ``carla.Client.apply_batch_sync()`` to actually reset. Returns: list[carla.command]: """ if self._controller: self._controller.reset() wp = random.choice(self._alf_world.get_waypoints()) goal_loc = wp.transform.location self._goal_location = np.array([goal_loc.x, goal_loc.y, goal_loc.z], dtype=np.float32) forbidden_locations = [] for v in self._alf_world.get_actors(): if v.id == self._actor.id: continue forbidden_locations.append( self._alf_world.get_actor_location(v.id)) # find a waypoint far enough from other vehicles ok = False i = 0 while not ok and i < 100: wp = random.choice(self._alf_world.get_waypoints()) loc = wp.transform.location ok = True for other_loc in forbidden_locations: if loc.distance(other_loc) < 10.: ok = False break i += 1 assert ok, "Fail to find new position" # loc.z + 0.27531 to avoid Z-collision, see Carla documentation for # carla.Map.get_spawn_points(). The value used by carla is slightly # smaller: 0.27530714869499207 loc = carla.Location(loc.x, loc.y, loc.z + 0.3) commands = [ carla.command.ApplyTransform( self._actor, carla.Transform(loc, wp.transform.rotation)), carla.command.ApplyVelocity(self._actor, carla.Vector3D()), carla.command.ApplyAngularVelocity(self._actor, carla.Vector3D()) ] self._max_frame = None self._done = False self._prev_location = loc self._prev_action = np.zeros( self.action_spec().shape, dtype=np.float32) self._alf_world.update_actor_location(self._actor.id, loc) self._route_length = self._navigation.set_destination(goal_loc) if self._data_collection_mode: self._data_agent.set_destination() self._prev_collision = False # whether there is collision in the previous frame self._collision = False # whether there is collision in the current frame self._collision_loc = None # the location of the car when it starts to have collision self._prev_violated_red_light_id = None self._prev_encountered_red_light_id = None self._prev_encountered_red_light_dist = 1e10 # The intermediate goal for sparse reward self._intermediate_goal_index = min(self._sparse_reward_index_interval, self._navigation.num_waypoints - 1) # The location of the car when the intermediate goal is set self._intermediate_start = _to_numpy_loc(loc) self._episode_reward = 0. self._unrecorded_distance_reward = 0. self._is_first_step = True self._speed_limit = None # when resetting, use the globally closest speed limit sign for update self.update_speed_limit(dis_threshold=-1) return commands
[docs] def destroy(self): """Get the commands for destroying the player. Use carla.Client.apply_batch_sync() to actually destroy the sensor. Returns: list[carla.command]: """ commands = [] for sensor in self._observation_sensors.values(): commands.extend(sensor.destroy()) commands.extend(self._lane_invasion_sensor.destroy()) commands.append(carla.command.DestroyActor(self._actor)) if self._surface is not None: import pygame pygame.quit() return commands
[docs] def observation_spec(self): """Get the observation spec. Returns: nested TensorSpec: """ return self._observation_spec
[docs] def observation_desc(self): """Get the description about the observation. Returns: nested str: each str corresponds to one TensorSpec from ``observatin_spec()``. """ return self._observation_desc
[docs] def action_spec(self): """Get the action spec. If ``controller`` is provided at ``__init__()``, the action_spec is given by ``controller``. Otherwise, the action is a 4-D vector of [throttle, steer, brake, reverse], where throttle is in [-1.0, 1.0] (negative value is same as zero), steer is in [-1.0, 1.0], brake is in [-1.0, 1.0] (negative value is same as zero), and reverse is interpreted as a boolean value with values greater than 0.5 corrsponding to True. Returns: nested BoundedTensorSpec: """ if self._controller is not None: return self._controller.action_spec() else: return alf.BoundedTensorSpec([4], minimum=[-1., -1., -1., 0.], maximum=[1., 1., 1., 1.])
[docs] def info_spec(self): """Get the info spec.""" return self._info_spec
[docs] def action_desc(self): """Get the description about the action. Returns: nested str: each str corresponds to one TensorSpec from ``action_spec()``. """ if self._controller is not None: return self._controller.action_desc() else: return ( "4-D vector of [throttle, steer, brake, reverse], where " "throttle is in [-1.0, 1.0] (negative value is same as zero), " "steer is in [-1.0, 1.0], brake is in [-1.0, 1.0] (negative value " "is same as zero), and reverse is interpreted as a boolean value " "with values greater than 0.5 corrsponding to True.")
[docs] def reward_spec(self): """Get the reward spec.""" return alf.TensorSpec([Player.REWARD_DIMENSION])
def _get_goal(self): return _calculate_relative_position(self._actor.get_transform(), self._goal_location)
[docs] def update_speed_limit(self, dis_threshold=10): """Update the speed limit of the actor according to the active speed limit sign. The speed limit is updated when passing by a speed limit sign. Args: dis_threshold (float): the distance in meter within which to consider the speed limit sign as active. The one closest to the actor in the active set will be used as the current speed limit. If a negative value is provided, all speed limit signs are taken into considerations for determining the closest one. Returns: float: speed limit in m/s """ updated_speed_limit = self._alf_world.get_active_speed_limit( self._actor, dis_threshold) if updated_speed_limit is not None: self._speed_limit = updated_speed_limit
def _get_agent_speed(self): v = self._actor.get_velocity() speed = np.linalg.norm(np.array([v.x, v.y, v.z], dtype=np.float)) return speed
[docs] def get_overspeed_amount(self): """Get the difference between the actor's speed and the speed limit, lower bounded by 0. Returns: float: - 0. if actor's ``_speed_limit`` is None or speed is lower than speed limit - the amount of the actor's speed over the speed limit otherwise """ speed = self._get_agent_speed() if self._speed_limit is None or speed < self._speed_limit: return 0. else: return speed - self._speed_limit
[docs] def get_current_time_step(self, current_frame): """Get the current time step for the player. Args: current_frame (int): current simulation frame no. Returns: TimeStep: all elements are ``np.ndarray`` or ``np.number``. """ obs = dict() for sensor_name, sensor in self._observation_sensors.items(): obs[sensor_name] = sensor.get_current_observation(current_frame) obs['goal'] = self._get_goal() self._alf_world.update_actor_location(self._actor.id, self._actor.get_location()) v = self._actor.get_velocity() obs['velocity'] = _calculate_relative_velocity( self._actor.get_transform(), _to_numpy_loc(v)) self._current_distance = np.linalg.norm(obs['goal']) prev_loc = _to_numpy_loc(self._prev_location) curr_loc = _to_numpy_loc(self._actor.get_location()) reward_vector = np.zeros(Player.REWARD_DIMENSION, np.float32) reward = 0. discount = 1.0 # this dictionary structure is used for describing the occurrences # of different types events appeared in the current time step. info = OrderedDict( success=np.float32(0.0), # success event (0/1) collision=np.float32(0.0), # all collision events (0/1) collision_front=np.float32(0.0), # front collision event (0/1) red_light_violated=np.float32(0.0), # violated red light (0/1) red_light_encountered=np.float32( 0.0), # encountered red light (0/1) overspeed=np.float32(0.0) # overspeed event (0/1) ) #===========================Infractions================================= # -------- Infraction 1: collision -------- # When the previous episode ends because of stucking at a collision with # another vehicle, it may get an additional collision event in the new frame # because the relocation of the car may happen after the simulation of the # moving. So we ignore the collision at the first step. self._collision = not np.all( obs['collision'] == 0) and not self._is_first_step if self._collision and not self._prev_collision: # We only report the first collision event among contiguous collision # events. info['collision'] = np.float32(1.0) collision_location_available = obs['collision'].ndim == 3 if collision_location_available: info['collision_front'] = np.float32( np.any(obs['collision'][:, 1, 0] > 0.5)) logging.info("actor=%d frame=%d COLLISION" % (self._actor.id, current_frame)) self._collision_loc = curr_loc self._collision_frame = current_frame # We don't want the collision penalty to be too large if the player # cannot even get enough positive moving reward. So we cap the penalty # at ``max(0., self._episode_reward)`` reward -= min( self._max_collision_penalty, Player.PENALTY_RATE_COLLISION * max(0., self._episode_reward)) reward_vector[Player.REWARD_COLLISION] = 1. # -------- Infraction 2: running red light -------- red_light_id, encountered_red_light_id, encountered_red_light_dist = \ self._alf_world.is_running_red_light(self._actor) if encountered_red_light_id is not None and encountered_red_light_id != self._prev_encountered_red_light_id: logging.info("actor=%d frame=%d Encountering RED_LIGHT" % (self._actor.id, current_frame)) info['red_light_encountered'] = np.float32(1.0) self._prev_encountered_red_light_id = encountered_red_light_id self._prev_encountered_red_light_dist = encountered_red_light_dist if red_light_id is not None and red_light_id != self._prev_violated_red_light_id: speed = self._get_agent_speed() logging.info("actor=%d frame=%d Running RED_LIGHT speed %2.1f" % (self._actor.id, current_frame, speed)) reward_vector[Player.REWARD_RED_LIGHT] = 1. info['red_light_violated'] = np.float32(1.0) if self._terminate_upon_infraction != "redlight": reward -= min( self._max_red_light_penalty, Player.PENALTY_RATE_RED_LIGHT * max( 0., self._episode_reward)) else: # to encourage stop at red-light, can set max_red_light_penalty # to a large value (e.g. 1000) and set terminate_upon_infraction # to "redlight" reward -= self._max_red_light_penalty # reward proportional to 1 - speed / capped_speed for encourating # stopping at redlight red_light_reward = ( 1 - min(speed / 5, 1)) * 0.5 * self._max_red_light_penalty reward += red_light_reward self._prev_violated_red_light_id = red_light_id if self._max_frame is None: step_type = ds.StepType.FIRST max_frames = math.ceil( (self._route_length / self._min_speed + self._additional_time) / self._delta_seconds) self._max_frame = current_frame + max_frames elif (self._current_distance < self._success_distance_thresh and self._actor.get_velocity() == carla.Location(0., 0., 0.)): # TODO: include waypoint orientation as success critiria step_type = ds.StepType.LAST reward += self._success_reward reward_vector[Player.REWARD_SUCCESS] = 1. discount = 0.0 info['success'] = np.float32(1.0) logging.info( "actor=%d frame=%d SUCCESS" % (self._actor.id, current_frame)) elif current_frame >= self._max_frame: logging.info("actor=%d frame=%d FAILURE: out of time" % (self._actor.id, current_frame)) step_type = ds.StepType.LAST elif (self._terminate_upon_infraction == "redlight" or self._terminate_upon_infraction == "all") and \ reward_vector[Player.REWARD_RED_LIGHT] > 0: # directly terminate upon redlight infractions; the corresponding # infraction penalty has already been assigned earlier step_type = ds.StepType.LAST discount = 0.0 logging.info("actor=%d frame=%d FAILURE: red light infraction" % (self._actor.id, current_frame)) elif (self._terminate_upon_infraction == "collision" or self._terminate_upon_infraction == "all") and \ reward_vector[Player.REWARD_COLLISION] > 0: # directly terminate upon collision infractions; the corresponding # infraction penalty has already been assigned earlier step_type = ds.StepType.LAST discount = 0.0 logging.info("actor=%d frame=%d FAILURE: collision infraction" % (self._actor.id, current_frame)) elif (self._collision_loc is not None and current_frame - self._collision_frame > self._max_stuck_at_collision_frames and np.linalg.norm(curr_loc - self._collision_loc) < self._stuck_at_collision_distance): logging.info("actor=%d frame=%d FAILURE: stuck at collision" % (self._actor.id, current_frame)) step_type = ds.StepType.LAST else: step_type = ds.StepType.MID distance_reward = 0 if self._sparse_reward: current_index = self._navigation.get_next_waypoint_index() if step_type == ds.StepType.LAST and info['success'] == 1.0: # Since the episode is finished, we need to incorporate the final # progress towards the goal as reward to encourage stopping near the goal. distance_reward = ( np.linalg.norm(self._intermediate_start - self._goal_location) - np.linalg.norm(curr_loc - self._goal_location)) elif self._intermediate_goal_index < current_index: # This means that the car has passed the intermediate goal. # And we give it a reward which is equal to the distance it # travels. intermediate_goal = self._navigation.get_waypoint( self._intermediate_goal_index) distance_reward = np.linalg.norm(intermediate_goal - self._intermediate_start) self._intermediate_start = intermediate_goal self._intermediate_goal_index = min( self._intermediate_goal_index + self._sparse_reward_index_interval, self._navigation.num_waypoints - 1) else: goal0 = obs['navigation'][2] # This is about 10m ahead distance_reward = (np.linalg.norm(prev_loc - goal0) - np.linalg.norm(curr_loc - goal0)) reward_vector[Player.REWARD_DISTANCE] = distance_reward if not self._allow_negative_distance_reward: distance_reward += self._unrecorded_distance_reward if distance_reward < 0: self._unrecorded_distance_reward = distance_reward distance_reward = 0 else: self._unrecorded_distance_reward = 0 reward += distance_reward overspeed = self.get_overspeed_amount() if overspeed > 0 and self._overspeed_penalty_weight > 0: logging.info("actor=%d frame=%d OVERSPEED" % (self._actor.id, current_frame)) reward_vector[Player.REWARD_OVERSPEED] = 1. info['overspeed'] = np.float32(1.0) reward -= self._overspeed_penalty_weight * overspeed * self._delta_seconds obs['navigation'] = _calculate_relative_position( self._actor.get_transform(), obs['navigation']) self._done = step_type == ds.StepType.LAST self._episode_reward += reward reward_vector[Player.REWARD_OVERALL] = reward self._current_time_step = ds.TimeStep( step_type=step_type, reward=reward_vector, discount=np.float32(discount), observation=obs, prev_action=self._prev_action, env_info=info) return self._current_time_step
[docs] def act(self, action): """Generate the carla command for taking the given action. Use ``carla.Client.apply_batch_sync()`` to actually destroy the sensor. Args: action (nested np.ndarray): Returns: list[carla.command]: """ self._prev_collision = self._collision self._prev_location = self._actor.get_location() self._is_first_step = False if self._done: return self.reset() if self._data_collection_mode: # TODO: add support to the usage of controller assert self._controller is None, ("controller is not supported " "in data collection currently") control = self._data_agent.run_step() control.manual_gear_shift = False action[0] = control.throttle action[1] = control.steer action[2] = control.brake if control.reverse: action[3] = 1 else: action[3] = 0 self._control = control else: if self._controller is not None: self._control = self._controller.act(action) else: self._control.throttle = max(float(action[0]), 0.0) self._control.steer = float(action[1]) self._control.brake = max(float(action[2]), 0.0) self._control.reverse = bool(action[3] > 0.5) self._prev_action = action self.update_speed_limit() return [carla.command.ApplyVehicleControl(self._actor, self._control)]
[docs] def render(self, mode): """Render the simulation. Args: mode (str): one of ['rgb_array', 'human'] Returns: one of the following: - None: if mode is 'human' - np.ndarray: the image of shape [height, width, channeles] if mode is 'rgb_array' """ import pygame if self._surface is None: pygame.init() pygame.font.init() self._clock = pygame.time.Clock() if self._camera_sensor: height, width = self._camera_sensor.observation_spec( ).shape[1:3] height, width = get_scaled_image_size(height, width) else: height = MINIMUM_RENDER_HEIGHT width = MINIMUM_RENDER_WIDTH if mode == 'human': self._surface = pygame.display.set_mode( (width, height), pygame.HWSURFACE | pygame.DOUBLEBUF) else: self._surface = pygame.Surface((width, height)) if mode == 'human': self._clock.tick_busy_loop(1000) if self._camera_sensor: self._camera_sensor.render(self._surface) obs = self._current_time_step.observation env_info = self._current_time_step.env_info np_precision = np.get_printoptions()['precision'] np.set_printoptions(precision=1) info_text = [ 'FPS: %6.2f' % self._clock.get_fps(), 'GPS: (%7.4f, %8.4f, %5.2f)' % tuple(obs['gnss'].tolist()) \ if 'gnss' in obs.keys() else '', 'Goal: (%7.1f, %8.1f, %5.1f)' % tuple(obs['goal'].tolist()) \ if 'goal' in obs.keys() else '', 'Ahead: (%7.1f, %8.1f, %5.1f)' % tuple( obs['navigation'][2].tolist()) \ if 'navigation' in obs.keys() else '', 'Distance: %7.2f' % np.linalg.norm(obs['goal']) \ if 'goal' in obs.keys() else '', 'Velocity: (%4.1f, %4.1f, %4.1f) m/s' % tuple( obs['velocity'].tolist()) \ if 'velocity' in obs.keys() else '', 'Acceleration: (%4.1f, %4.1f, %4.1f)' % tuple( obs['imu'][0:3].tolist()) \ if 'imu' in obs.keys() else '', 'Compass: %5.1f' % math.degrees(float(obs['imu'][6])) \ if 'imu' in obs.keys() else '', 'Throttle: %4.2f' % self._control.throttle, 'Brake: %4.2f' % self._control.brake, 'Steer: %4.2f' % self._control.steer, 'Reverse: %4s' % self._control.reverse, 'Reward: (%s)' % self._current_time_step.reward, 'Route Length: %4.2f m' % self._route_length, 'Speed Limit: %4.2f m/s' % self._speed_limit, 'Red light zone: %1d' % (self._prev_encountered_red_light_id != None), 'Red light violation: %1d' % env_info['red_light_violated'], 'Red light dist: %4.2f' % self._prev_encountered_red_light_dist, ] info_text = [info for info in info_text if info != ''] np.set_printoptions(precision=np_precision) self._draw_text(info_text) if mode == 'human': pygame.display.flip() elif mode == 'rgb_array': if self._camera_sensor is not None: # (x, y, c) => (y, x, c) rgb_img = pygame.surfarray.array3d(self._surface).swapaxes( 0, 1) if 'navigation' in obs.keys() and self._render_waypoints: # index of waypoint to be rendered waypoint_index = np.arange(2, 5) nav_traj = obs['navigation'][waypoint_index] self._draw_ego_traj_on_image( nav_traj, rgb_img, camera_sensor=self._camera_sensor, color=(0, 255, 0), size=5, zero_world_z=True, interp_num=500) else: rgb_img = None if self._bev_sensor is not None: bev_img = self._bev_sensor.render() if rgb_img is not None: concat_img = np.zeros( (max(rgb_img.shape[0], bev_img.shape[0]), rgb_img.shape[1] + bev_img.shape[1], 3), np.uint8) concat_img[:rgb_img.shape[0], :rgb_img.shape[1]] = rgb_img concat_img[:bev_img.shape[0], -bev_img.shape[1]:] = bev_img rgb_img = concat_img else: rgb_img = bev_img return rgb_img else: raise ValueError("Unsupported render mode: %s" % mode)
def _draw_ego_traj_on_image(self, ego_points, rgb_img, camera_sensor, color=(255, 0, 0), size=3, forward_shift_delta=0, zero_world_z=False, append_self=False, interp_num=200): """Render points in ego coordinates on camera image. Args: ego_points (np.ndarray): [N, 3] rgb_img (np.ndarray): with the meaning of axis as (y, x, c) camera_sensor (CameraSensor): the camera sensor color (tuple[int]): color values for the [R, G, B] channels of the rendered points size (int): size of the rendered point in terms of pixels forward_shift_delta (int): the amount to be shifted for the points along the forward axis. This might be useful in some cases to shift the points to be within the camera's field of view zero_world_z (bool): whether set the z values of the transformed points in world coordinate to zero. This is useful to render points on the ground plane append_self (bool): whether append self location to the point set interp_num (int): the number of target elements to be obtained by interpolation Returns: np.ndarray: interpolated ego points or input ego points if no interpolation is applied """ # [N, 3] -> [3, N] ego_points = np.transpose(ego_points) if interp_num >= ego_points.shape[1]: time_index = np.linspace(0, 1, ego_points.shape[1]) interp_func = scipy.interpolate.interp1d( x=time_index, y=ego_points, axis=1) ego_interp = interp_func( np.linspace(time_index[0], time_index[-1], 100)) else: if interp_num > 0: common.warning_once( ("the specified number of elements after " "interpolation is smaller than the number of elements " "in the original trajectory; skipping interpolation")) ego_interp = ego_points # [3, N] -> [N, 3] ego_interp = np.transpose(ego_interp) nav_world = self._ego_to_world_position( ego_interp, append_self=append_self, forward_shift_delta=forward_shift_delta) if zero_world_z: nav_world[:, 2] = 0 camera_sensor._draw_world_points_on_image(nav_world, rgb_img, color, size) return ego_interp def _ego_to_world_position(self, ego_points, append_self=False, forward_shift_delta=0): """ Args: ego_points (np.ndarray): [N, 3] forward_shift_delta (int): the amount to be shifted for the points along the forward axis. This might be useful in some cases to shift the points to be within the camera's field of view Returns: np.ndarray: shape [N, 3] """ trans = self._actor.get_transform() self_loc = trans.location yaw = math.radians(trans.rotation.yaw) self_loc = np.array([self_loc.x, self_loc.y, self_loc.z]) self_loc = np.expand_dims(self_loc, axis=0) cos, sin = np.cos(yaw), np.sin(yaw) rot = np.array([[cos, -sin, 0.], [sin, cos, 0.], [0., 0., 1.]]) # shift along forward axis ego_points[:, 0] = ego_points[:, 0] + forward_shift_delta ego_points = ( np.matmul(ego_points, np.linalg.inv(rot)) + self_loc).astype( np.float32) if append_self: ego_points = np.concatenate([self_loc, ego_points], axis=0) return ego_points def _draw_text(self, texts): import os import pygame if self._font is None: font_name = 'courier' if os.name == 'nt' else 'mono' fonts = [x for x in pygame.font.get_fonts() if font_name in x] default_font = 'ubuntumono' mono = default_font if default_font in fonts else fonts[0] mono = pygame.font.match_font(mono) self._font = pygame.font.Font(mono, 12 if os.name == 'nt' else 14) info_surface = pygame.Surface((240, 240)) info_surface.set_alpha(100) self._surface.blit(info_surface, (0, 0)) v_offset = 4 for item in texts: surface = self._font.render(item, True, (255, 255, 255)) self._surface.blit(surface, (8, v_offset)) v_offset += 18
def _exec(command): stream = os.popen(command) ret = stream.read() stream.close() return ret
[docs]@alf.configurable class CarlaServer(object): """CarlaServer for doing the simulation.""" def __init__(self, rpc_port=2000, streaming_port=2001, docker_image="horizonrobotics/alf:0.0.6-carla0.9.9", quality_level="Low", carla_root="/home/carla", use_opengl=True): """ Args: rpc_port (int): port for RPC streaming_port (int): port for data streaming docker_image (str): If provided, will use the docker image to start the Carla server. Some valid images are "carlasim/carla:0.9.9" and "horionrobotics/alf:0.0.3-carla" quality_level (str): one of ['Low', 'Epic']. See the explanation at `<https://carla.readthedocs.io/en/latest/adv_rendering_options/#graphics-quality>`_ carla_root (str): directorcy where CarlaUE4.sh is in. The default value is correct for using docker image. If not using docker image, make sure you provide the correct path. This is the directory where you unzipped the file you downloaded from `<https://github.com/carla-simulator/carla/releases/tag/0.9.9>`_. use_opengl (bool): the default graphics engine of Carla is Vulkan, which is supposed to be better than OpenGL. However, Vulkan is not always available. It may not be installed or the nvidia driver does not support vulkan. """ assert quality_level in ['Low', 'Epic'], "Unknown quality level" use_docker = (not alf.utils.common.is_inside_docker_container() and docker_image) opengl = "-opengl" if use_opengl else "" if use_docker: dev = os.environ.get('CUDA_VISIBLE_DEVICES') if not dev: dev = 'all' command = ("docker run -d " "-p {rpc_port}:{rpc_port} " "-p {streaming_port}:{streaming_port} " "-u carla " "--rm --gpus device=" + dev + " " + docker_image + " {carla_root}/CarlaUE4.sh " "--carla-rpc-port={rpc_port} " "--carla-streaming-port={streaming_port} " "--quality-level={quality_level} {opengl}") else: assert os.path.exists(carla_root + "/CarlaUE4.sh"), ( "%s/CarlaUE4.sh " "does not exist. Please provide correct value for `carla_root`" % carla_root) # We do not use CarlaUE4.sh here in order to get the actual Carla # server processs so that we can kill it. command = ( "{carla_root}/CarlaUE4/Binaries/Linux/CarlaUE4-Linux-Shipping " "CarlaUE4 " # perhaps most system does not have vulkan support, so we use opengl "-carla-rpc-port={rpc_port} " "-carla-streaming-port={streaming_port} " "-quality-level={quality_level} {opengl}") command = command.format( rpc_port=rpc_port, streaming_port=streaming_port, quality_level=quality_level, carla_root=carla_root, opengl=opengl) logging.info("Starting Carla server: %s" % command) self._container_id = None self._process = None if use_docker: self._container_id = _exec(command) assert self._container_id, "Fail to start container" logging.info("Starting carla in container %s" % self._container_id) else: new_env = os.environ.copy() new_env['SDL_VIDEODRIVER'] = 'offscreen' self._process = subprocess.Popen( command.split(), stdout=sys.stdout, stderr=sys.stderr, env=new_env)
[docs] def stop(self): """Stop the carla server.""" if self._container_id: command = "docker kill %s" % self._container_id logging.info("Stopping Carla server: %s" % command) _exec(command) self._container_id = None if self._process: self._process.kill() self._process.communicate() self._process = None
def __del__(self): self.stop()
[docs]@alf.configurable class CarlaEnvironment(AlfEnvironment): """Carla simulation environment. In order to use it, you need to either download a valid docker image or a Carla package. """ # not all vehicles have functioning lights. (See https://carla.readthedocs.io/en/0.9.9/core_world/#weather) vehicles_with_functioning_lights = [ 'vehicle.audi.tt', 'vehicle.chevrolet.impala', 'vehicle.dodge_charger.police', 'vehicle.audi.etron', 'vehicle.lincoln.mkz2017', 'vehicle.mustang.mustang', 'vehicle.tesla.model3', 'vehicle.volkswagen.t2', ] def __init__(self, batch_size, map_name, vehicle_filter='vehicle.*', walker_filter='walker.pedestrian.*', num_other_vehicles=0, num_walkers=0, percentage_walkers_running=0.1, percentage_walkers_crossing=0.1, global_distance_to_leading_vehicle=2.0, use_hybrid_physics_mode=True, safe=True, day_length=0., max_weather_length=0, weather_transition_ratio=0.1, step_time=0.05): """ Args: batch_size (int): the number of learning vehicles. map_name (str): the name of the map (e.g. "Town01") vehicle_filter (str): the filter for getting the blueprints for training vehicles. The filter for other vehicles will always be obtained using 'vehicle.*'. walker_filter (str): the filter for getting walker blueprints. num_other_vehicles (int): the number of autopilot vehicles num_walkers (int): the number of walkers global_distance_to_leading_vehicle (str): the autopiloted vehicles will try to keep such distance from other vehicles. percentage_walkers_running (float): percent of running walkers percentage_walkers_crossing (float): percent of walkers walking across the road. use_hybrid_physics_mode (bool): If true, the autopiloted vehicle will not use physics for simulation if it is far from other vehicles. safe (bool): avoid spawning vehicles prone to accidents. day_length (float): number of seconds of a day. If 0, the time of the day will not change. max_weather_length (float): the number of seconds each weather will last at the most. The actual lasting time (actual_weather_length) of each randomized weather setting is randomly sampled from [0.25 * max_weather_length, max_weather_length]. If max_weather_length is set to 0, the weather won't change. Otherwise, weather randomization is turned on and we will sample a new set of parameters after reaching actual_weather_length for each sampled weather. Note that we exclude ``sun_azimuth_angle`` and ``sun_altitude_angle`` from weather randomization and they are controlled separately by ``day_length`` in a more realistic way. weather_transition_ratio (float): the ratio between the length of the weather transtion part and the actual lasting time of the new weather including the transition phase. It has no effect if max_weather_length is 0. step_time (float): how many seconds does each step of simulation represents. """ super().__init__() with common.get_unused_port(2000, n=2) as (rpc_port, streaming_port): self._server = CarlaServer(rpc_port, streaming_port) self._batch_size = batch_size self._num_other_vehicles = num_other_vehicles self._num_walkers = num_walkers self._percentage_walkers_running = percentage_walkers_running self._percentage_walkers_crossing = percentage_walkers_crossing self._day_length = day_length self._time_of_the_day = 0.5 * day_length self._step_time = step_time self._max_weather_length = max_weather_length self._actual_weather_length = 0 self._weather_length_count = 0 self._weather_transition_ratio = min(1.0, weather_transition_ratio) self._world = None try: for i in range(20): try: logging.info( "Waiting for server to start. Try %d" % (i + 1)) self._client = carla.Client("localhost", rpc_port) self._world = self._client.load_world(map_name) break except RuntimeError: continue finally: if self._world is None: self._server.stop() assert self._world is not None, "Fail to start server." logging.info("Server started.") self._traffic_manager = None if self._num_other_vehicles + self._num_walkers > 0: with common.get_unused_port(8000, n=1) as tm_port: self._traffic_manager = self._client.get_trafficmanager( tm_port) # Need to set traffic manager (TM) to synchronous mode, since # traffic manager is designed to work in synchronous mode. # Both the CARLA server and TM should be set to synchronous # in order to function properly. Using TM in asynchronous mode # can lead to unexpected and undesirable results according to # https://carla.readthedocs.io/en/latest/adv_traffic_manager/#synchronous-mode self._traffic_manager.set_synchronous_mode(True) self._traffic_manager.set_hybrid_physics_mode( use_hybrid_physics_mode) self._traffic_manager.set_global_distance_to_leading_vehicle( global_distance_to_leading_vehicle) self._client.set_timeout(20) self._alf_world = World(self._world) self._safe = safe self._vehicle_filter = vehicle_filter self._walker_filter = walker_filter settings = self._world.get_settings() settings.synchronous_mode = True settings.fixed_delta_seconds = step_time self._world.apply_settings(settings) self._map_name = map_name self._spawn_vehicles() self._spawn_walkers() self._observation_spec = self._players[0].observation_spec() self._action_spec = self._players[0].action_spec() self._env_info_spec = self._players[0].info_spec() self._reward_spec = self._players[0].reward_spec() # metadata property is required by video recording self.metadata = { 'render.modes': ['human', 'rgb_array'], 'video.frames_per_second': 1 / step_time } def _spawn_vehicles(self): blueprints = self._world.get_blueprint_library().filter( self._vehicle_filter) assert len( blueprints) > 0, "Cannot find vehicle '%s'" % self._vehicle_filter def _filter_safe(blueprints): blueprints = [ x for x in blueprints if int(x.get_attribute('number_of_wheels')) == 4 ] blueprints = [x for x in blueprints if not x.id.endswith('isetta')] blueprints = [ x for x in blueprints if not x.id.endswith('carlacola') ] blueprints = [ x for x in blueprints if not x.id.endswith('cybertruck') ] return [x for x in blueprints if not x.id.endswith('t2')] if self._safe: blueprints = _filter_safe(blueprints) assert len( blueprints ) > 0, "Cannot find safe vehicle '%s'" % self._vehicle_filter blueprints = [ x for x in blueprints if x.id in self.vehicles_with_functioning_lights ] assert len(blueprints) > 0, ( "Cannot find vehicle with functioning lights") other_blueprints = self._world.get_blueprint_library().filter( 'vehicle.*') other_blueprints = [ x for x in other_blueprints if x.id in self.vehicles_with_functioning_lights ] spawn_points = self._world.get_map().get_spawn_points() number_of_spawn_points = len(spawn_points) num_vehicles = self._batch_size + self._num_other_vehicles if num_vehicles <= number_of_spawn_points: random.shuffle(spawn_points) else: raise ValueError( "requested %d vehicles, but could only find %d spawn points" % (self._batch_size, number_of_spawn_points)) commands = [] for i, transform in enumerate(spawn_points[:num_vehicles]): if i < self._batch_size: blueprint = random.choice(blueprints) else: blueprint = random.choice(other_blueprints) if blueprint.has_attribute('color'): color = random.choice( blueprint.get_attribute('color').recommended_values) blueprint.set_attribute('color', color) if blueprint.has_attribute('driver_id'): driver_id = random.choice( blueprint.get_attribute('driver_id').recommended_values) blueprint.set_attribute('driver_id', driver_id) if i < self._batch_size: blueprint.set_attribute('role_name', 'hero') else: blueprint.set_attribute('role_name', 'autopilot') command = carla.command.SpawnActor(blueprint, transform) if i >= self._batch_size: # managed by traffic manager command = command.then( carla.command.SetAutopilot( carla.command.FutureActor, True, self._traffic_manager.get_port())) commands.append(command) self._players = [] self._other_vehicles = [] responses = self._client.apply_batch_sync(commands, True) for i, response in enumerate(responses): if response.error: logging.error(response.error) continue vehicle = self._world.get_actor(response.actor_id) if i < self._batch_size: self._players.append(Player(vehicle, self._alf_world)) else: self._other_vehicles.append(vehicle) self._alf_world.add_actor(vehicle) self._alf_world.update_actor_location(vehicle.id, spawn_points[i].location) assert len(self._players) + len( self._other_vehicles) == num_vehicles, ( "Fail to create %s vehicles" % num_vehicles) def _update_weather(self): """Update the weather settings. This function sample a new set of weather parameters once the actual lasting time of the previous weather setting is up. The actual lasting time of each weather setting is randomly sampled from [0.25 * max_weather_length, max_weather_length]. After the termination of the previous weather setting, there is a transition phase to linearly transit from the old to the new weather settings. """ # sample new weather parameter if self._weather_length_count == 0: # the actual lasting time of the new weather self._actual_weather_length = max( 0.25, np.random.rand()) * self._max_weather_length new_weather_parameter = WeatherParameters( *np.random.uniform(0, 100, len(WeatherParameters()))) weather = self._world.get_weather() prev_weather_parameter = extract_weather_parameters(weather) trans_steps = max( 1, self._actual_weather_length * self._weather_transition_ratio / self._step_time) self._dp = ( new_weather_parameter - prev_weather_parameter) / trans_steps # for the initial transition period, we smoothly transit between two # weather settings if (self._weather_length_count <= self._actual_weather_length * self._weather_transition_ratio): weather = self._world.get_weather() updated_weather = adjust_weather_parameters(weather, self._dp) self._world.set_weather(updated_weather) self._weather_length_count += self._step_time if self._weather_length_count >= self._actual_weather_length: self._weather_length_count = 0 self._actual_weather_length = 0 def _spawn_walkers(self): walker_blueprints = self._world.get_blueprint_library().filter( self._walker_filter) # 1. take all the random locations to spawn spawn_points = [] for _ in range(self._num_walkers): spawn_point = carla.Transform() loc = self._world.get_random_location_from_navigation() if loc != None: spawn_point.location = loc spawn_points.append(spawn_point) # 2. we spawn the walker object commands = [] walker_speeds = [] for spawn_point in spawn_points: walker_bp = random.choice(walker_blueprints) # set as not invincible if walker_bp.has_attribute('is_invincible'): walker_bp.set_attribute('is_invincible', 'false') # set the max speed if walker_bp.has_attribute('speed'): if (random.random() > self._percentage_walkers_running): # walking walker_speeds.append( walker_bp.get_attribute('speed').recommended_values[1]) else: # running walker_speeds.append( walker_bp.get_attribute('speed').recommended_values[2]) else: logging.info("Walker has no speed") walker_speeds.append(0.0) commands.append(carla.command.SpawnActor(walker_bp, spawn_point)) responses = self._client.apply_batch_sync(commands, True) walker_speeds2 = [] self._walkers = [] for response, walker_speed, spawn_point in zip( responses, walker_speeds, spawn_points): if response.error: logging.error( "%s: %s" % (response.error, spawn_point.location)) continue walker = self._world.get_actor(response.actor_id) self._walkers.append({"walker": walker}) walker_speeds2.append(walker_speed) walker_speeds = walker_speeds2 # 3. we spawn the walker controller commands = [] walker_controller_bp = self._world.get_blueprint_library().find( 'controller.ai.walker') for walker in self._walkers: commands.append( carla.command.SpawnActor(walker_controller_bp, carla.Transform(), walker["walker"].id)) responses = self._client.apply_batch_sync(commands, True) for response, walker in zip(responses, self._walkers): if response.error: logging.error(response.error) continue walker["controller"] = self._world.get_actor(response.actor_id) # wait for a tick to ensure client receives the last transform of the walkers we have just created self._world.tick() # 5. initialize each controller and set target to walk to (list is [controler, actor, controller, actor ...]) # set how many pedestrians can cross the road self._world.set_pedestrians_cross_factor( self._percentage_walkers_crossing) for walker, walker_speed in zip(self._walkers, walker_speeds): # start walker walker['controller'].start() # set walk to random point location = self._world.get_random_location_from_navigation() walker['controller'].go_to_location(location) # max speed walker['controller'].set_max_speed(float(walker_speed)) self._alf_world.add_actor(walker['walker']) self._alf_world.update_actor_location(walker['walker'].id, location) def _clear(self): if self._world is None: return if self._players: commands = [] for player in self._players: commands.extend(player.destroy()) for response in self._client.apply_batch_sync(commands, True): if response.error: logging.error(response.error) self._players.clear() commands = [] for vehicle in self._other_vehicles: commands.append(carla.command.DestroyActor(vehicle)) for walker in self._walkers: walker['controller'].stop() commands.append(carla.command.DestroyActor(walker['controller'])) commands.append(carla.command.DestroyActor(walker['walker'])) if commands: for response in self._client.apply_batch_sync(commands, True): if response.error: logging.error(response.error) self._other_vehicles.clear() self._walkers.clear() @property def is_tensor_based(self): return True @property def batched(self): return True @property def batch_size(self): return self._batch_size
[docs] def env_info_spec(self): return self._env_info_spec
[docs] def observation_spec(self): return self._observation_spec
[docs] def observation_desc(self): return self._players[0].observation_desc()
[docs] def action_spec(self): return self._action_spec
[docs] def action_desc(self): return self._players[0].action_desc()
[docs] def reward_spec(self): return self._reward_spec
[docs] def close(self): self._clear() self._server.stop()
def __del__(self): self.close() @property def players(self): """Get all the players in the environment. Returns: list[Player]: """ return self._players
[docs] def render(self, mode): return self._players[0].render(mode)
def _step(self, action): action = alf.nest.map_structure(lambda x: x.cpu().numpy(), action) commands = [] for player, act in zip(self._players, action): commands.extend(player.act(act)) for response in self._client.apply_batch_sync(commands): if response.error: logging.error(response.error) if self._day_length > 0: self._update_time_of_the_day() if self._max_weather_length > 0: self._update_weather() self._current_frame = self._world.tick() self._alf_world.on_tick() for vehicle in self._other_vehicles: self._alf_world.update_actor_location(vehicle.id, vehicle.get_location()) for walker in self._walkers: actor = walker['walker'] self._alf_world.update_actor_location(actor.id, actor.get_location()) return self._get_current_time_step() def _update_time_of_the_day(self): light_state = None if 0.25 * self._day_length - self._step_time < self._time_of_the_day <= 0.25 * self._day_length: light_state = carla.VehicleLightState.NONE elif 0.75 * self._day_length - self._step_time < self._time_of_the_day <= 0.75 * self._day_length: light_state = carla.VehicleLightState( carla.VehicleLightState.Position | carla.VehicleLightState.LowBeam) if light_state is not None: for player in self._players: player._actor.set_light_state(light_state) for vehicle in self._other_vehicles: vehicle.set_light_state(light_state) self._time_of_the_day += self._step_time if self._time_of_the_day >= self._day_length: self._time_of_the_day -= self._day_length weather = self._world.get_weather() azimuth = weather.sun_azimuth_angle + 360 / self._day_length * self._step_time if azimuth > 360: azimuth -= 360 weather.sun_azimuth_angle = azimuth altitude = self._time_of_the_day / self._day_length * 2 if altitude > 1: altitude = 2. - altitude weather.sun_altitude_angle = altitude * 180 - 90 self._world.set_weather(weather) def _get_current_time_step(self): time_step = [ player.get_current_time_step(self._current_frame) for player in self._players ] time_step = alf.nest.map_structure(lambda *a: np.stack(a), *time_step) time_step = alf.nest.map_structure(torch.as_tensor, time_step) common.check_numerics(time_step) return time_step._replace(env_id=torch.arange(self._batch_size)) def _reset(self): commands = [] for player in self._players: commands.extend(player.reset()) for response in self._client.apply_batch_sync(commands): if response.error: logging.error(response.error) self._current_frame = self._world.tick() self._alf_world.on_tick() return self._get_current_time_step()
[docs]@alf.configurable(whitelist=['wrappers']) def load(map_name, batch_size, wrappers=[]): """Load CarlaEnvironment Args: map_name (str): name of the map. Currently available maps are: 'Town01, Town02', 'Town03', 'Town04', 'Town05', 'Town06', 'Town07', and 'Town10HD' batch_size (int): the number of vehicles in the simulation. wrappers (list[AlfEnvironmentBaseWrapper]): environment wrappers Returns: CarlaEnvironment """ env = CarlaEnvironment(batch_size, map_name) for wrapper in wrappers: env = wrapper(env) return env
load.batched = True